C22H20N2O8S — CID 126727714
1-[[4-(7-methoxy-6-methylsulfonyloxyquinolin-4-yl)oxyphenyl]carbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 126727714) has the molecular formula C22H20N2O8S and a molecular weight of 472.48 g/mol. Its IUPAC name is 1-[[4-(7-methoxy-6-methylsulfonyloxyquinolin-4-yl)oxyphenyl]carbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[4-(7-methoxy-6-methylsulfonyloxyquinolin-4-yl)oxyphenyl]carbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 126727714 |
| Molecular Formula | C22H20N2O8S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 1-[[4-(7-methoxy-6-methylsulfonyloxyquinolin-4-yl)oxyphenyl]carbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)O)CC4)cc3)c2cc1OS(C)(=O)=O |
| InChI | InChI=1S/C22H20N2O8S/c1-30-18-12-16-15(11-19(18)32-33(2,28)29)17(7-10-23-16)31-14-5-3-13(4-6-14)24-20(25)22(8-9-22)21(26)27/h3-7,10-12H,8-9H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | IRKPZFISKVEUFM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|