C33H31N3O5 — CID 146332455
1-N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(3-phenyl-1-bicyclo[1.1.1]pentanyl)cyclopropane-1,1-dicarboxamide (PubChem CID 146332455) has the molecular formula C33H31N3O5 and a molecular weight of 549.63 g/mol. Its IUPAC name is 1-N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(3-phenyl-1-bicyclo[1.1.1]pentanyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(3-phenyl-1-bicyclo[1.1.1]pentanyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 146332455 |
| Molecular Formula | C33H31N3O5 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | 1-N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-1-N'-(3-phenyl-1-bicyclo[1.1.1]pentanyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)NC56CC(c7ccccc7)(C5)C6)CC4)cc3)c2cc1OC |
| InChI | InChI=1S/C33H31N3O5/c1-39-27-16-24-25(17-28(27)40-2)34-15-12-26(24)41-23-10-8-22(9-11-23)35-29(37)33(13-14-33)30(38)36-32-18-31(19-32,20-32)21-6-4-3-5-7-21/h3-12,15-17H,13-14,18-20H2,1-2H3,(H,35,37)(H,36,38) |
| InChIKey | KMFFIVGPXLNQFT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|