C21H18N2O4 — CID 130296636
methyl 1-[(4-quinolin-4-yloxyphenyl)carbamoyl]cyclopropane-1-carboxylate (PubChem CID 130296636) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is methyl 1-[(4-quinolin-4-yloxyphenyl)carbamoyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[(4-quinolin-4-yloxyphenyl)carbamoyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 130296636 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | methyl 1-[(4-quinolin-4-yloxyphenyl)carbamoyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(C(=O)Nc2ccc(Oc3ccnc4ccccc34)cc2)CC1 |
| InChI | InChI=1S/C21H18N2O4/c1-26-20(25)21(11-12-21)19(24)23-14-6-8-15(9-7-14)27-18-10-13-22-17-5-3-2-4-16(17)18/h2-10,13H,11-12H2,1H3,(H,23,24) |
| InChIKey | ZKPRVDWCTFSADV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|