C20H15N3O3 — CID 71982272
4-methyl-N-(4-quinolin-4-yloxyphenyl)-1,3-oxazole-5-carboxamide (PubChem CID 71982272) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 4-methyl-N-(4-quinolin-4-yloxyphenyl)-1,3-oxazole-5-carboxamide.
| Compound Name | 4-methyl-N-(4-quinolin-4-yloxyphenyl)-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 71982272 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4-methyl-N-(4-quinolin-4-yloxyphenyl)-1,3-oxazole-5-carboxamide |
| SMILES | Cc1ncoc1C(=O)Nc1ccc(Oc2ccnc3ccccc23)cc1 |
| InChI | InChI=1S/C20H15N3O3/c1-13-19(25-12-22-13)20(24)23-14-6-8-15(9-7-14)26-18-10-11-21-17-5-3-2-4-16(17)18/h2-12H,1H3,(H,23,24) |
| InChIKey | CKTDKCVGBIRHKS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |