C27H22N6O4 — CID 58931078
1-(1H-benzimidazol-2-yl)-3-[4-[6-isocyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]urea (PubChem CID 58931078) has the molecular formula C27H22N6O4 and a molecular weight of 494.51 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-yl)-3-[4-[6-isocyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-(1H-benzimidazol-2-yl)-3-[4-[6-isocyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 58931078 |
| Molecular Formula | C27H22N6O4 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 1-(1H-benzimidazol-2-yl)-3-[4-[6-isocyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]urea |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(NC(=O)Nc4nc5ccccc5[nH]4)cc3)ccnc2cc1OCCOC |
| InChI | InChI=1S/C27H22N6O4/c1-28-23-15-19-22(16-25(23)36-14-13-35-2)29-12-11-24(19)37-18-9-7-17(8-10-18)30-27(34)33-26-31-20-5-3-4-6-21(20)32-26/h3-12,15-16H,13-14H2,2H3,(H3,30,31,32,33,34) |
| InChIKey | QTPFQSPIUNTSIB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|