C28H23N5O5 — CID 58931414
1-[4-[6-isocyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-3-(2-oxo-1,3-dihydroindol-5-yl)urea (PubChem CID 58931414) has the molecular formula C28H23N5O5 and a molecular weight of 509.52 g/mol. Its IUPAC name is 1-[4-[6-isocyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-3-(2-oxo-1,3-dihydroindol-5-yl)urea.
| Compound Name | 1-[4-[6-isocyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
|---|---|
| PubChem CID | 58931414 |
| Molecular Formula | C28H23N5O5 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 1-[4-[6-isocyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyphenyl]-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(NC(=O)Nc4ccc5c(c4)CC(=O)N5)cc3)ccnc2cc1OCCOC |
| InChI | InChI=1S/C28H23N5O5/c1-29-24-15-21-23(16-26(24)37-12-11-36-2)30-10-9-25(21)38-20-6-3-18(4-7-20)31-28(35)32-19-5-8-22-17(13-19)14-27(34)33-22/h3-10,13,15-16H,11-12,14H2,2H3,(H,33,34)(H2,31,32,35) |
| InChIKey | WQMLHTHPIWAVMI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|