C29H24FN5O5 — CID 22936755
1-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxy-2-fluorophenyl]-3-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)urea (PubChem CID 22936755) has the molecular formula C29H24FN5O5 and a molecular weight of 541.54 g/mol. Its IUPAC name is 1-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxy-2-fluorophenyl]-3-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)urea.
| Compound Name | 1-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxy-2-fluorophenyl]-3-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)urea |
|---|---|
| PubChem CID | 22936755 |
| Molecular Formula | C29H24FN5O5 |
| Molecular Weight | 541.54 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 1-[4-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxy-2-fluorophenyl]-3-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)urea |
| SMILES | COCCOc1cc2nccc(Oc3ccc(NC(=O)Nc4ccc5c(c4)CCC(=O)N5)c(F)c3)c2cc1C#N |
| InChI | InChI=1S/C29H24FN5O5/c1-38-10-11-39-27-15-25-21(13-18(27)16-31)26(8-9-32-25)40-20-4-6-24(22(30)14-20)35-29(37)33-19-3-5-23-17(12-19)2-7-28(36)34-23/h3-6,8-9,12-15H,2,7,10-11H2,1H3,(H,34,36)(H2,33,35,37) |
| InChIKey | KYRJNYDDSQYYBU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|