C23H14F2N4NaO3+ — CID 135829377
sodium 1-[4-(6-cyano-7-hydroxyquinolin-4-yl)oxy-2-fluorophenyl]-3-(4-fluorophenyl)urea (PubChem CID 135829377) has the molecular formula C23H14F2N4NaO3+ and a molecular weight of 455.38 g/mol. Its IUPAC name is sodium 1-[4-(6-cyano-7-hydroxyquinolin-4-yl)oxy-2-fluorophenyl]-3-(4-fluorophenyl)urea.
| Compound Name | sodium 1-[4-(6-cyano-7-hydroxyquinolin-4-yl)oxy-2-fluorophenyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 135829377 |
| Molecular Formula | C23H14F2N4NaO3+ |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | sodium 1-[4-(6-cyano-7-hydroxyquinolin-4-yl)oxy-2-fluorophenyl]-3-(4-fluorophenyl)urea |
| SMILES | N#Cc1cc2c(Oc3ccc(NC(=O)Nc4ccc(F)cc4)c(F)c3)ccnc2cc1O.[Na+] |
| InChI | InChI=1S/C23H14F2N4O3.Na/c24-14-1-3-15(4-2-14)28-23(31)29-19-6-5-16(10-18(19)25)32-22-7-8-27-20-11-21(30)13(12-26)9-17(20)22;/h1-11,30H,(H2,28,29,31);/q;+1 |
| InChIKey | OLOPICORCUWLFS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 107.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |