C30H28F3N5O3 — CID 10166579
1-[4-[6-cyano-7-[3-(diethylamino)propoxy]quinolin-4-yl]oxy-2-fluorophenyl]-3-(2,4-difluorophenyl)urea (PubChem CID 10166579) has the molecular formula C30H28F3N5O3 and a molecular weight of 563.58 g/mol. Its IUPAC name is 1-[4-[6-cyano-7-[3-(diethylamino)propoxy]quinolin-4-yl]oxy-2-fluorophenyl]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[4-[6-cyano-7-[3-(diethylamino)propoxy]quinolin-4-yl]oxy-2-fluorophenyl]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 10166579 |
| Molecular Formula | C30H28F3N5O3 |
| Molecular Weight | 563.58 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 1-[4-[6-cyano-7-[3-(diethylamino)propoxy]quinolin-4-yl]oxy-2-fluorophenyl]-3-(2,4-difluorophenyl)urea |
| SMILES | CCN(CC)CCCOc1cc2nccc(Oc3ccc(NC(=O)Nc4ccc(F)cc4F)c(F)c3)c2cc1C#N |
| InChI | InChI=1S/C30H28F3N5O3/c1-3-38(4-2)12-5-13-40-29-17-27-22(14-19(29)18-34)28(10-11-35-27)41-21-7-9-26(24(33)16-21)37-30(39)36-25-8-6-20(31)15-23(25)32/h6-11,14-17H,3-5,12-13H2,1-2H3,(H2,36,37,39) |
| InChIKey | UKGTUIKXYXNNFH-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.58 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|