C24H16F2N4O3 — CID 22936794
1-[4-(6-cyano-7-methoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea (PubChem CID 22936794) has the molecular formula C24H16F2N4O3 and a molecular weight of 446.41 g/mol. Its IUPAC name is 1-[4-(6-cyano-7-methoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[4-(6-cyano-7-methoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 22936794 |
| Molecular Formula | C24H16F2N4O3 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 1-[4-(6-cyano-7-methoxyquinolin-4-yl)oxyphenyl]-3-(2,4-difluorophenyl)urea |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)Nc4ccc(F)cc4F)cc3)c2cc1C#N |
| InChI | InChI=1S/C24H16F2N4O3/c1-32-23-12-21-18(10-14(23)13-27)22(8-9-28-21)33-17-5-3-16(4-6-17)29-24(31)30-20-7-2-15(25)11-19(20)26/h2-12H,1H3,(H2,29,30,31) |
| InChIKey | BLLGPBIBQDKJFW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |