C24H21FN4O5S — CID 58931501
1-(4-fluorophenyl)-3-[4-[6-(methanesulfonamido)-7-methoxyquinolin-4-yl]oxyphenyl]urea (PubChem CID 58931501) has the molecular formula C24H21FN4O5S and a molecular weight of 496.52 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[6-(methanesulfonamido)-7-methoxyquinolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[6-(methanesulfonamido)-7-methoxyquinolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 58931501 |
| Molecular Formula | C24H21FN4O5S |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[6-(methanesulfonamido)-7-methoxyquinolin-4-yl]oxyphenyl]urea |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)Nc4ccc(F)cc4)cc3)c2cc1NS(C)(=O)=O |
| InChI | InChI=1S/C24H21FN4O5S/c1-33-23-14-20-19(13-21(23)29-35(2,31)32)22(11-12-26-20)34-18-9-7-17(8-10-18)28-24(30)27-16-5-3-15(25)4-6-16/h3-14,29H,1-2H3,(H2,27,28,30) |
| InChIKey | NTELUERHIRVGDS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |