C27H23F2N3O6 — CID 22935461
N-(2,4-difluorophenyl)-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-2-methoxypropanediamide (PubChem CID 22935461) has the molecular formula C27H23F2N3O6 and a molecular weight of 523.49 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-2-methoxypropanediamide.
| Compound Name | N-(2,4-difluorophenyl)-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-2-methoxypropanediamide |
|---|---|
| PubChem CID | 22935461 |
| Molecular Formula | C27H23F2N3O6 |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | N-(2,4-difluorophenyl)-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-2-methoxypropanediamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C(OC)C(=O)Nc4ccc(F)cc4F)cc3)c2cc1OC |
| InChI | InChI=1S/C27H23F2N3O6/c1-35-23-13-18-21(14-24(23)36-2)30-11-10-22(18)38-17-7-5-16(6-8-17)31-26(33)25(37-3)27(34)32-20-9-4-15(28)12-19(20)29/h4-14,25H,1-3H3,(H,31,33)(H,32,34) |
| InChIKey | KLSOZBDIPIFHQL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|