C29H25F2NO6 — CID 58249497
1-(2,4-difluorophenyl)-5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-methoxypentane-2,4-dione (PubChem CID 58249497) has the molecular formula C29H25F2NO6 and a molecular weight of 521.52 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-methoxypentane-2,4-dione.
| Compound Name | 1-(2,4-difluorophenyl)-5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-methoxypentane-2,4-dione |
|---|---|
| PubChem CID | 58249497 |
| Molecular Formula | C29H25F2NO6 |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 1-(2,4-difluorophenyl)-5-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]-3-methoxypentane-2,4-dione |
| SMILES | COc1cc2nccc(Oc3ccc(CC(=O)C(OC)C(=O)Cc4ccc(F)cc4F)cc3)c2cc1OC |
| InChI | InChI=1S/C29H25F2NO6/c1-35-27-15-21-23(16-28(27)36-2)32-11-10-26(21)38-20-8-4-17(5-9-20)12-24(33)29(37-3)25(34)13-18-6-7-19(30)14-22(18)31/h4-11,14-16,29H,12-13H2,1-3H3 |
| InChIKey | RDWWCJCVMGWDGS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|