C30H28F3N5O3 — CID 59439303
1-(2,4-difluorophenyl)-3-[2-fluoro-4-[6-isocyano-7-[2-(pentan-3-ylamino)ethoxy]quinolin-4-yl]oxyphenyl]urea (PubChem CID 59439303) has the molecular formula C30H28F3N5O3 and a molecular weight of 563.58 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[2-fluoro-4-[6-isocyano-7-[2-(pentan-3-ylamino)ethoxy]quinolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[2-fluoro-4-[6-isocyano-7-[2-(pentan-3-ylamino)ethoxy]quinolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 59439303 |
| Molecular Formula | C30H28F3N5O3 |
| Molecular Weight | 563.58 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[2-fluoro-4-[6-isocyano-7-[2-(pentan-3-ylamino)ethoxy]quinolin-4-yl]oxyphenyl]urea |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(NC(=O)Nc4ccc(F)cc4F)c(F)c3)ccnc2cc1OCCNC(CC)CC |
| InChI | InChI=1S/C30H28F3N5O3/c1-4-19(5-2)35-12-13-40-29-17-26-21(16-27(29)34-3)28(10-11-36-26)41-20-7-9-25(23(33)15-20)38-30(39)37-24-8-6-18(31)14-22(24)32/h6-11,14-17,19,35H,4-5,12-13H2,1-2H3,(H2,37,38,39) |
| InChIKey | YCHLXDQFAOQKKN-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 88.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.58 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|