C27H25FN6O4S — CID 58931469
1-[2-fluoro-4-[7-[(2R)-2-hydroxy-3-pyrrolidin-1-ylpropoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 58931469) has the molecular formula C27H25FN6O4S and a molecular weight of 548.60 g/mol. Its IUPAC name is 1-[2-fluoro-4-[7-[(2R)-2-hydroxy-3-pyrrolidin-1-ylpropoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[2-fluoro-4-[7-[(2R)-2-hydroxy-3-pyrrolidin-1-ylpropoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 58931469 |
| Molecular Formula | C27H25FN6O4S |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 1-[2-fluoro-4-[7-[(2R)-2-hydroxy-3-pyrrolidin-1-ylpropoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(NC(=O)Nc4nccs4)c(F)c3)ccnc2cc1OC[C@H](O)CN1CCCC1 |
| InChI | InChI=1S/C27H25FN6O4S/c1-29-23-13-19-22(14-25(23)37-16-17(35)15-34-9-2-3-10-34)30-7-6-24(19)38-18-4-5-21(20(28)12-18)32-26(36)33-27-31-8-11-39-27/h4-8,11-14,17,35H,2-3,9-10,15-16H2,(H2,31,32,33,36)/t17-/m1/s1 |
| InChIKey | IGCNOKAMISJGSP-QGZVFWFLSA-N |
| XLogP | 5.65 |
| TPSA | 113.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|