C29H26N6O3S — CID 58930928
5-[6-isocyano-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxy-N-(1,3-thiazol-2-yl)indole-1-carboxamide (PubChem CID 58930928) has the molecular formula C29H26N6O3S and a molecular weight of 538.63 g/mol. Its IUPAC name is 5-[6-isocyano-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxy-N-(1,3-thiazol-2-yl)indole-1-carboxamide.
| Compound Name | 5-[6-isocyano-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxy-N-(1,3-thiazol-2-yl)indole-1-carboxamide |
|---|---|
| PubChem CID | 58930928 |
| Molecular Formula | C29H26N6O3S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 5-[6-isocyano-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxy-N-(1,3-thiazol-2-yl)indole-1-carboxamide |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc4c(ccn4C(=O)Nc4nccs4)c3)ccnc2cc1OCC1CCN(C)CC1 |
| InChI | InChI=1S/C29H26N6O3S/c1-30-24-16-22-23(17-27(24)37-18-19-6-11-34(2)12-7-19)31-9-5-26(22)38-21-3-4-25-20(15-21)8-13-35(25)29(36)33-28-32-10-14-39-28/h3-5,8-10,13-17,19H,6-7,11-12,18H2,2H3,(H,32,33,36) |
| InChIKey | POFNOMYRKHMTIE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|