C22H17N3O5 — CID 68668381
5-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyindole-1-carboxylic acid (PubChem CID 68668381) has the molecular formula C22H17N3O5 and a molecular weight of 403.39 g/mol. Its IUPAC name is 5-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyindole-1-carboxylic acid.
| Compound Name | 5-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyindole-1-carboxylic acid |
|---|---|
| PubChem CID | 68668381 |
| Molecular Formula | C22H17N3O5 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 5-[6-cyano-7-(2-methoxyethoxy)quinolin-4-yl]oxyindole-1-carboxylic acid |
| SMILES | COCCOc1cc2nccc(Oc3ccc4c(ccn4C(=O)O)c3)c2cc1C#N |
| InChI | InChI=1S/C22H17N3O5/c1-28-8-9-29-21-12-18-17(11-15(21)13-23)20(4-6-24-18)30-16-2-3-19-14(10-16)5-7-25(19)22(26)27/h2-7,10-12H,8-9H2,1H3,(H,26,27) |
| InChIKey | PYNZOOVABVBIHX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|