C38H32N6O8 — CID 160747273
4-(4-aminophenoxy)-7-(2-methoxyethoxy)quinoline-6-carbonitrile;7-(2-methoxyethoxy)-4-(4-nitrophenoxy)quinoline-6-carbonitrile (PubChem CID 160747273) has the molecular formula C38H32N6O8 and a molecular weight of 700.71 g/mol. Its IUPAC name is 4-(4-aminophenoxy)-7-(2-methoxyethoxy)quinoline-6-carbonitrile;7-(2-methoxyethoxy)-4-(4-nitrophenoxy)quinoline-6-carbonitrile.
| Compound Name | 4-(4-aminophenoxy)-7-(2-methoxyethoxy)quinoline-6-carbonitrile;7-(2-methoxyethoxy)-4-(4-nitrophenoxy)quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 160747273 |
| Molecular Formula | C38H32N6O8 |
| Molecular Weight | 700.71 g/mol |
| Exact Mass | 700.23 |
| IUPAC Name | 4-(4-aminophenoxy)-7-(2-methoxyethoxy)quinoline-6-carbonitrile;7-(2-methoxyethoxy)-4-(4-nitrophenoxy)quinoline-6-carbonitrile |
| SMILES | COCCOc1cc2nccc(Oc3ccc(N)cc3)c2cc1C#N.COCCOc1cc2nccc(Oc3ccc([N+](=O)[O-])cc3)c2cc1C#N |
| InChI | InChI=1S/C19H15N3O5.C19H17N3O3/c1-25-8-9-26-19-11-17-16(10-13(19)12-20)18(6-7-21-17)27-15-4-2-14(3-5-15)22(23)24;1-23-8-9-24-19-11-17-16(10-13(19)12-20)18(6-7-22-17)25-15-4-2-14(21)3-5-15/h2-7,10-11H,8-9H2,1H3;2-7,10-11H,8-9,21H2,1H3 |
| InChIKey | RWISFTDYPNBCDX-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 197.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.71 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|