C16H13N3O5 — CID 139349383
2,3-dimethoxy-8-(4-nitrophenoxy)-1,5-naphthyridine (PubChem CID 139349383) has the molecular formula C16H13N3O5 and a molecular weight of 327.30 g/mol. Its IUPAC name is 2,3-dimethoxy-8-(4-nitrophenoxy)-1,5-naphthyridine.
| Compound Name | 2,3-dimethoxy-8-(4-nitrophenoxy)-1,5-naphthyridine |
|---|---|
| PubChem CID | 139349383 |
| Molecular Formula | C16H13N3O5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2,3-dimethoxy-8-(4-nitrophenoxy)-1,5-naphthyridine |
| SMILES | COc1cc2nccc(Oc3ccc([N+](=O)[O-])cc3)c2nc1OC |
| InChI | InChI=1S/C16H13N3O5/c1-22-14-9-12-15(18-16(14)23-2)13(7-8-17-12)24-11-5-3-10(4-6-11)19(20)21/h3-9H,1-2H3 |
| InChIKey | VXSNQECYTWERKT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|