C17H16N4O6 — CID 139349408
2-methoxy-3-(2-methoxyethoxy)-8-[(5-nitro-2-pyridinyl)oxy]-1,5-naphthyridine (PubChem CID 139349408) has the molecular formula C17H16N4O6 and a molecular weight of 372.34 g/mol. Its IUPAC name is 2-methoxy-3-(2-methoxyethoxy)-8-[(5-nitro-2-pyridinyl)oxy]-1,5-naphthyridine.
| Compound Name | 2-methoxy-3-(2-methoxyethoxy)-8-[(5-nitro-2-pyridinyl)oxy]-1,5-naphthyridine |
|---|---|
| PubChem CID | 139349408 |
| Molecular Formula | C17H16N4O6 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-methoxy-3-(2-methoxyethoxy)-8-[(5-nitro-2-pyridinyl)oxy]-1,5-naphthyridine |
| SMILES | COCCOc1cc2nccc(Oc3ccc([N+](=O)[O-])cn3)c2nc1OC |
| InChI | InChI=1S/C17H16N4O6/c1-24-7-8-26-14-9-12-16(20-17(14)25-2)13(5-6-18-12)27-15-4-3-11(10-19-15)21(22)23/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | XVHNPHCLYIYOLZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 118.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|