C17H14ClFN2O5 — CID 133054183
4-(3-fluoro-4-nitrophenoxy)-6,7-dimethoxyquinoline;hydrochloride (PubChem CID 133054183) has the molecular formula C17H14ClFN2O5 and a molecular weight of 380.76 g/mol. Its IUPAC name is 4-(3-fluoro-4-nitrophenoxy)-6,7-dimethoxyquinoline;hydrochloride.
| Compound Name | 4-(3-fluoro-4-nitrophenoxy)-6,7-dimethoxyquinoline;hydrochloride |
|---|---|
| PubChem CID | 133054183 |
| Molecular Formula | C17H14ClFN2O5 |
| Molecular Weight | 380.76 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 4-(3-fluoro-4-nitrophenoxy)-6,7-dimethoxyquinoline;hydrochloride |
| SMILES | COc1cc2nccc(Oc3ccc([N+](=O)[O-])c(F)c3)c2cc1OC.Cl |
| InChI | InChI=1S/C17H13FN2O5.ClH/c1-23-16-8-11-13(9-17(16)24-2)19-6-5-15(11)25-10-3-4-14(20(21)22)12(18)7-10;/h3-9H,1-2H3;1H |
| InChIKey | YLNKHBBFOFPBEM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.76 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|