C28H27N5O3 — CID 67202393
5-[6-cyano-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxy-N-cyclopropylindole-1-carboxamide (PubChem CID 67202393) has the molecular formula C28H27N5O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is 5-[6-cyano-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxy-N-cyclopropylindole-1-carboxamide.
| Compound Name | 5-[6-cyano-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxy-N-cyclopropylindole-1-carboxamide |
|---|---|
| PubChem CID | 67202393 |
| Molecular Formula | C28H27N5O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 5-[6-cyano-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxy-N-cyclopropylindole-1-carboxamide |
| SMILES | N#Cc1cc2c(Oc3ccc4c(ccn4C(=O)NC4CC4)c3)ccnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C28H27N5O3/c29-16-20-14-23-24(15-27(20)35-17-18-5-9-30-10-6-18)31-11-7-26(23)36-22-3-4-25-19(13-22)8-12-33(25)28(34)32-21-1-2-21/h3-4,7-8,11-15,18,21,30H,1-2,5-6,9-10,17H2,(H,32,34) |
| InChIKey | QAPAZWDXLUBQGK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 101.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |