C33H35N5O5 — CID 58931123
tert-butyl 4-[[4-[1-(cyclopropylcarbamoyl)indol-5-yl]oxy-6-isocyanoquinolin-7-yl]oxymethyl]piperidine-1-carboxylate (PubChem CID 58931123) has the molecular formula C33H35N5O5 and a molecular weight of 581.67 g/mol. Its IUPAC name is tert-butyl 4-[[4-[1-(cyclopropylcarbamoyl)indol-5-yl]oxy-6-isocyanoquinolin-7-yl]oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[1-(cyclopropylcarbamoyl)indol-5-yl]oxy-6-isocyanoquinolin-7-yl]oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58931123 |
| Molecular Formula | C33H35N5O5 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | tert-butyl 4-[[4-[1-(cyclopropylcarbamoyl)indol-5-yl]oxy-6-isocyanoquinolin-7-yl]oxymethyl]piperidine-1-carboxylate |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc4c(ccn4C(=O)NC4CC4)c3)ccnc2cc1OCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C33H35N5O5/c1-33(2,3)43-32(40)37-14-10-21(11-15-37)20-41-30-19-26-25(18-27(30)34-4)29(9-13-35-26)42-24-7-8-28-22(17-24)12-16-38(28)31(39)36-23-5-6-23/h7-9,12-13,16-19,21,23H,5-6,10-11,14-15,20H2,1-3H3,(H,36,39) |
| InChIKey | FCDKWCYURFIEAL-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|