C27H28ClN5O4 — CID 58931034
1-[2-chloro-4-[7-[(2S)-2-hydroxy-3-pyrrolidin-1-ylpropoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-cyclopropylurea (PubChem CID 58931034) has the molecular formula C27H28ClN5O4 and a molecular weight of 522.01 g/mol. Its IUPAC name is 1-[2-chloro-4-[7-[(2S)-2-hydroxy-3-pyrrolidin-1-ylpropoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-cyclopropylurea.
| Compound Name | 1-[2-chloro-4-[7-[(2S)-2-hydroxy-3-pyrrolidin-1-ylpropoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 58931034 |
| Molecular Formula | C27H28ClN5O4 |
| Molecular Weight | 522.01 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 1-[2-chloro-4-[7-[(2S)-2-hydroxy-3-pyrrolidin-1-ylpropoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-cyclopropylurea |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(NC(=O)NC4CC4)c(Cl)c3)ccnc2cc1OC[C@@H](O)CN1CCCC1 |
| InChI | InChI=1S/C27H28ClN5O4/c1-29-24-13-20-23(14-26(24)36-16-18(34)15-33-10-2-3-11-33)30-9-8-25(20)37-19-6-7-22(21(28)12-19)32-27(35)31-17-4-5-17/h6-9,12-14,17-18,34H,2-5,10-11,15-16H2,(H2,31,32,35)/t18-/m0/s1 |
| InChIKey | KFCQIIIWTUOCMG-SFHVURJKSA-N |
| XLogP | 5.35 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.01 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|