C27H28FN5O3 — CID 58931266
1-cyclopropyl-3-[2-fluoro-4-[6-isocyano-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxyphenyl]urea (PubChem CID 58931266) has the molecular formula C27H28FN5O3 and a molecular weight of 489.55 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-fluoro-4-[6-isocyano-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-cyclopropyl-3-[2-fluoro-4-[6-isocyano-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 58931266 |
| Molecular Formula | C27H28FN5O3 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 1-cyclopropyl-3-[2-fluoro-4-[6-isocyano-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxyphenyl]urea |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(NC(=O)NC4CC4)c(F)c3)ccnc2cc1OCC1CCN(C)CC1 |
| InChI | InChI=1S/C27H28FN5O3/c1-29-24-14-20-23(15-26(24)35-16-17-8-11-33(2)12-9-17)30-10-7-25(20)36-19-5-6-22(21(28)13-19)32-27(34)31-18-3-4-18/h5-7,10,13-15,17-18H,3-4,8-9,11-12,16H2,2H3,(H2,31,32,34) |
| InChIKey | BRXLDHVELHWWQC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 80.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|