C27H18F3N7O3 — CID 58931239
1-(2,4-difluorophenyl)-3-[2-fluoro-4-[6-isocyano-7-[2-(triazol-1-yl)ethoxy]quinolin-4-yl]oxyphenyl]urea (PubChem CID 58931239) has the molecular formula C27H18F3N7O3 and a molecular weight of 545.48 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[2-fluoro-4-[6-isocyano-7-[2-(triazol-1-yl)ethoxy]quinolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[2-fluoro-4-[6-isocyano-7-[2-(triazol-1-yl)ethoxy]quinolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 58931239 |
| Molecular Formula | C27H18F3N7O3 |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[2-fluoro-4-[6-isocyano-7-[2-(triazol-1-yl)ethoxy]quinolin-4-yl]oxyphenyl]urea |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(NC(=O)Nc4ccc(F)cc4F)c(F)c3)ccnc2cc1OCCn1ccnn1 |
| InChI | InChI=1S/C27H18F3N7O3/c1-31-24-14-18-23(15-26(24)39-11-10-37-9-8-33-36-37)32-7-6-25(18)40-17-3-5-22(20(30)13-17)35-27(38)34-21-4-2-16(28)12-19(21)29/h2-9,12-15H,10-11H2,(H2,34,35,38) |
| InChIKey | PGRUSGAYIOHMIO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|