C30H26F3N3O3 — CID 58272165
1-(2,4-difluorophenyl)-3-[4-[7-[3-(dimethylamino)propoxy]-6-isocyanoquinolin-4-yl]oxy-2-fluorophenyl]propan-2-one (PubChem CID 58272165) has the molecular formula C30H26F3N3O3 and a molecular weight of 533.55 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[4-[7-[3-(dimethylamino)propoxy]-6-isocyanoquinolin-4-yl]oxy-2-fluorophenyl]propan-2-one.
| Compound Name | 1-(2,4-difluorophenyl)-3-[4-[7-[3-(dimethylamino)propoxy]-6-isocyanoquinolin-4-yl]oxy-2-fluorophenyl]propan-2-one |
|---|---|
| PubChem CID | 58272165 |
| Molecular Formula | C30H26F3N3O3 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[4-[7-[3-(dimethylamino)propoxy]-6-isocyanoquinolin-4-yl]oxy-2-fluorophenyl]propan-2-one |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(CC(=O)Cc4ccc(F)cc4F)c(F)c3)ccnc2cc1OCCCN(C)C |
| InChI | InChI=1S/C30H26F3N3O3/c1-34-28-17-24-27(18-30(28)38-12-4-11-36(2)3)35-10-9-29(24)39-23-8-6-20(26(33)16-23)14-22(37)13-19-5-7-21(31)15-25(19)32/h5-10,15-18H,4,11-14H2,2-3H3 |
| InChIKey | CCJUEJHZCKVJKP-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 56.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|