C34H31F2N3O4 — CID 58272443
4-[4-[3-fluoro-4-[3-(4-fluorophenyl)-2-oxopropyl]phenoxy]-6-isocyanoquinolin-7-yl]oxy-1-piperidin-1-ylbutan-1-one (PubChem CID 58272443) has the molecular formula C34H31F2N3O4 and a molecular weight of 583.64 g/mol. Its IUPAC name is 4-[4-[3-fluoro-4-[3-(4-fluorophenyl)-2-oxopropyl]phenoxy]-6-isocyanoquinolin-7-yl]oxy-1-piperidin-1-ylbutan-1-one.
| Compound Name | 4-[4-[3-fluoro-4-[3-(4-fluorophenyl)-2-oxopropyl]phenoxy]-6-isocyanoquinolin-7-yl]oxy-1-piperidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 58272443 |
| Molecular Formula | C34H31F2N3O4 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | 4-[4-[3-fluoro-4-[3-(4-fluorophenyl)-2-oxopropyl]phenoxy]-6-isocyanoquinolin-7-yl]oxy-1-piperidin-1-ylbutan-1-one |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(CC(=O)Cc4ccc(F)cc4)c(F)c3)ccnc2cc1OCCCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C34H31F2N3O4/c1-37-31-21-28-30(22-33(31)42-17-5-6-34(41)39-15-3-2-4-16-39)38-14-13-32(28)43-27-12-9-24(29(36)20-27)19-26(40)18-23-7-10-25(35)11-8-23/h7-14,20-22H,2-6,15-19H2 |
| InChIKey | UCQPUDQFVCEABO-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 73.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|