C31H26F3N3O4 — CID 58272839
1-(2,4-difluorophenyl)-3-[2-fluoro-4-[6-isocyano-7-(2-morpholin-4-ylethoxy)quinolin-4-yl]oxyphenyl]propan-2-one (PubChem CID 58272839) has the molecular formula C31H26F3N3O4 and a molecular weight of 561.56 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[2-fluoro-4-[6-isocyano-7-(2-morpholin-4-ylethoxy)quinolin-4-yl]oxyphenyl]propan-2-one.
| Compound Name | 1-(2,4-difluorophenyl)-3-[2-fluoro-4-[6-isocyano-7-(2-morpholin-4-ylethoxy)quinolin-4-yl]oxyphenyl]propan-2-one |
|---|---|
| PubChem CID | 58272839 |
| Molecular Formula | C31H26F3N3O4 |
| Molecular Weight | 561.56 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[2-fluoro-4-[6-isocyano-7-(2-morpholin-4-ylethoxy)quinolin-4-yl]oxyphenyl]propan-2-one |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(CC(=O)Cc4ccc(F)cc4F)c(F)c3)ccnc2cc1OCCN1CCOCC1 |
| InChI | InChI=1S/C31H26F3N3O4/c1-35-29-18-25-28(19-31(29)40-13-10-37-8-11-39-12-9-37)36-7-6-30(25)41-24-5-3-21(27(34)17-24)15-23(38)14-20-2-4-22(32)16-26(20)33/h2-7,16-19H,8-15H2 |
| InChIKey | ROJMCDHUDYPRJY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 65.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|