C29H32ClN3O3 — CID 58272819
1-[2-chloro-4-[7-[3-(diethylamino)propoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-cyclopropylpropan-2-one (PubChem CID 58272819) has the molecular formula C29H32ClN3O3 and a molecular weight of 506.05 g/mol. Its IUPAC name is 1-[2-chloro-4-[7-[3-(diethylamino)propoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-cyclopropylpropan-2-one.
| Compound Name | 1-[2-chloro-4-[7-[3-(diethylamino)propoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-cyclopropylpropan-2-one |
|---|---|
| PubChem CID | 58272819 |
| Molecular Formula | C29H32ClN3O3 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 1-[2-chloro-4-[7-[3-(diethylamino)propoxy]-6-isocyanoquinolin-4-yl]oxyphenyl]-3-cyclopropylpropan-2-one |
| SMILES | [C-]#[N+]c1cc2c(Oc3ccc(CC(=O)CC4CC4)c(Cl)c3)ccnc2cc1OCCCN(CC)CC |
| InChI | InChI=1S/C29H32ClN3O3/c1-4-33(5-2)13-6-14-35-29-19-26-24(18-27(29)31-3)28(11-12-32-26)36-23-10-9-21(25(30)17-23)16-22(34)15-20-7-8-20/h9-12,17-20H,4-8,13-16H2,1-2H3 |
| InChIKey | JQRCTELQDMSZFU-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 56.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|