C30H31N5O5 — CID 91611866
(1-carbamoylcyclopropyl) 5-[6-cyano-7-[3-(diethylamino)propoxy]quinolin-4-yl]oxyindole-1-carboxylate (PubChem CID 91611866) has the molecular formula C30H31N5O5 and a molecular weight of 541.61 g/mol. Its IUPAC name is (1-carbamoylcyclopropyl) 5-[6-cyano-7-[3-(diethylamino)propoxy]quinolin-4-yl]oxyindole-1-carboxylate.
| Compound Name | (1-carbamoylcyclopropyl) 5-[6-cyano-7-[3-(diethylamino)propoxy]quinolin-4-yl]oxyindole-1-carboxylate |
|---|---|
| PubChem CID | 91611866 |
| Molecular Formula | C30H31N5O5 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | (1-carbamoylcyclopropyl) 5-[6-cyano-7-[3-(diethylamino)propoxy]quinolin-4-yl]oxyindole-1-carboxylate |
| SMILES | CCN(CC)CCCOc1cc2nccc(Oc3ccc4c(ccn4C(=O)OC4(C(N)=O)CC4)c3)c2cc1C#N |
| InChI | InChI=1S/C30H31N5O5/c1-3-34(4-2)13-5-15-38-27-18-24-23(17-21(27)19-31)26(8-12-33-24)39-22-6-7-25-20(16-22)9-14-35(25)29(37)40-30(10-11-30)28(32)36/h6-9,12,14,16-18H,3-5,10-11,13,15H2,1-2H3,(H2,32,36) |
| InChIKey | YUUHWQUJUDERMQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 132.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|