C24H24N4O4S — CID 58931280
7-methoxy-4-[1-(3-methylsulfanylpropylcarbamoyl)indol-5-yl]oxyquinoline-6-carboxamide (PubChem CID 58931280) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is 7-methoxy-4-[1-(3-methylsulfanylpropylcarbamoyl)indol-5-yl]oxyquinoline-6-carboxamide.
| Compound Name | 7-methoxy-4-[1-(3-methylsulfanylpropylcarbamoyl)indol-5-yl]oxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 58931280 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 7-methoxy-4-[1-(3-methylsulfanylpropylcarbamoyl)indol-5-yl]oxyquinoline-6-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc4c(ccn4C(=O)NCCCSC)c3)c2cc1C(N)=O |
| InChI | InChI=1S/C24H24N4O4S/c1-31-22-14-19-17(13-18(22)23(25)29)21(6-9-26-19)32-16-4-5-20-15(12-16)7-10-28(20)24(30)27-8-3-11-33-2/h4-7,9-10,12-14H,3,8,11H2,1-2H3,(H2,25,29)(H,27,30) |
| InChIKey | XBDUHDYKQNGMHV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|