C25H24F2N6O5 — CID 87307976
5-[6-[[carbamoyl(2-fluoroethyl)amino]carbamoyl]-7-methoxyquinolin-4-yl]oxy-N-(2-fluoroethyl)indole-1-carboxamide (PubChem CID 87307976) has the molecular formula C25H24F2N6O5 and a molecular weight of 526.50 g/mol. Its IUPAC name is 5-[6-[[carbamoyl(2-fluoroethyl)amino]carbamoyl]-7-methoxyquinolin-4-yl]oxy-N-(2-fluoroethyl)indole-1-carboxamide.
| Compound Name | 5-[6-[[carbamoyl(2-fluoroethyl)amino]carbamoyl]-7-methoxyquinolin-4-yl]oxy-N-(2-fluoroethyl)indole-1-carboxamide |
|---|---|
| PubChem CID | 87307976 |
| Molecular Formula | C25H24F2N6O5 |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 5-[6-[[carbamoyl(2-fluoroethyl)amino]carbamoyl]-7-methoxyquinolin-4-yl]oxy-N-(2-fluoroethyl)indole-1-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc4c(ccn4C(=O)NCCF)c3)c2cc1C(=O)NN(CCF)C(N)=O |
| InChI | InChI=1S/C25H24F2N6O5/c1-37-22-14-19-17(13-18(22)23(34)31-33(11-7-27)24(28)35)21(4-8-29-19)38-16-2-3-20-15(12-16)5-10-32(20)25(36)30-9-6-26/h2-5,8,10,12-14H,6-7,9,11H2,1H3,(H2,28,35)(H,30,36)(H,31,34) |
| InChIKey | CDULOMJYGQNGQD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 140.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|