C27H23N5O3 — CID 58272814
4-[1-(ethylcarbamoyl)indol-5-yl]oxy-7-methyl-N-pyridin-2-ylquinoline-6-carboxamide (PubChem CID 58272814) has the molecular formula C27H23N5O3 and a molecular weight of 465.51 g/mol. Its IUPAC name is 4-[1-(ethylcarbamoyl)indol-5-yl]oxy-7-methyl-N-pyridin-2-ylquinoline-6-carboxamide.
| Compound Name | 4-[1-(ethylcarbamoyl)indol-5-yl]oxy-7-methyl-N-pyridin-2-ylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 58272814 |
| Molecular Formula | C27H23N5O3 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 4-[1-(ethylcarbamoyl)indol-5-yl]oxy-7-methyl-N-pyridin-2-ylquinoline-6-carboxamide |
| SMILES | CCNC(=O)n1ccc2cc(Oc3ccnc4cc(C)c(C(=O)Nc5ccccn5)cc34)ccc21 |
| InChI | InChI=1S/C27H23N5O3/c1-3-28-27(34)32-13-10-18-15-19(7-8-23(18)32)35-24-9-12-29-22-14-17(2)20(16-21(22)24)26(33)31-25-6-4-5-11-30-25/h4-16H,3H2,1-2H3,(H,28,34)(H,30,31,33) |
| InChIKey | LZLAGUDNSBTJLO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |