C19H19N5O3 — CID 23072181
N-methyl-5-[[2-(prop-2-enylcarbamoylamino)-4-pyridinyl]oxy]indole-1-carboxamide (PubChem CID 23072181) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-methyl-5-[[2-(prop-2-enylcarbamoylamino)-4-pyridinyl]oxy]indole-1-carboxamide.
| Compound Name | N-methyl-5-[[2-(prop-2-enylcarbamoylamino)-4-pyridinyl]oxy]indole-1-carboxamide |
|---|---|
| PubChem CID | 23072181 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-methyl-5-[[2-(prop-2-enylcarbamoylamino)-4-pyridinyl]oxy]indole-1-carboxamide |
| SMILES | C=CCNC(=O)Nc1cc(Oc2ccc3c(ccn3C(=O)NC)c2)ccn1 |
| InChI | InChI=1S/C19H19N5O3/c1-3-8-22-18(25)23-17-12-15(6-9-21-17)27-14-4-5-16-13(11-14)7-10-24(16)19(26)20-2/h3-7,9-12H,1,8H2,2H3,(H,20,26)(H2,21,22,23,25) |
| InChIKey | KGONJALKQIWWAB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|