C26H36N4O4 — CID 167497339
6-(2-methoxyethoxy)-N-methyl-5-[[2-(2,4,4-trimethylpentan-2-ylamino)-4-pyridinyl]oxy]indole-1-carboxamide (PubChem CID 167497339) has the molecular formula C26H36N4O4 and a molecular weight of 468.60 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-N-methyl-5-[[2-(2,4,4-trimethylpentan-2-ylamino)-4-pyridinyl]oxy]indole-1-carboxamide.
| Compound Name | 6-(2-methoxyethoxy)-N-methyl-5-[[2-(2,4,4-trimethylpentan-2-ylamino)-4-pyridinyl]oxy]indole-1-carboxamide |
|---|---|
| PubChem CID | 167497339 |
| Molecular Formula | C26H36N4O4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 6-(2-methoxyethoxy)-N-methyl-5-[[2-(2,4,4-trimethylpentan-2-ylamino)-4-pyridinyl]oxy]indole-1-carboxamide |
| SMILES | CNC(=O)n1ccc2cc(Oc3ccnc(NC(C)(C)CC(C)(C)C)c3)c(OCCOC)cc21 |
| InChI | InChI=1S/C26H36N4O4/c1-25(2,3)17-26(4,5)29-23-15-19(8-10-28-23)34-22-14-18-9-11-30(24(31)27-6)20(18)16-21(22)33-13-12-32-7/h8-11,14-16H,12-13,17H2,1-7H3,(H,27,31)(H,28,29) |
| InChIKey | QVPCLGFFKBKBEG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|