C33H38N4O6 — CID 90348966
4-[1-(2-hydroxyethyl)piperidin-4-yl]-N-[4-[6-(2-methoxyethoxy)-1-propanoylindol-5-yl]oxy-2-pyridinyl]benzamide (PubChem CID 90348966) has the molecular formula C33H38N4O6 and a molecular weight of 586.69 g/mol. Its IUPAC name is 4-[1-(2-hydroxyethyl)piperidin-4-yl]-N-[4-[6-(2-methoxyethoxy)-1-propanoylindol-5-yl]oxy-2-pyridinyl]benzamide.
| Compound Name | 4-[1-(2-hydroxyethyl)piperidin-4-yl]-N-[4-[6-(2-methoxyethoxy)-1-propanoylindol-5-yl]oxy-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 90348966 |
| Molecular Formula | C33H38N4O6 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | 4-[1-(2-hydroxyethyl)piperidin-4-yl]-N-[4-[6-(2-methoxyethoxy)-1-propanoylindol-5-yl]oxy-2-pyridinyl]benzamide |
| SMILES | CCC(=O)n1ccc2cc(Oc3ccnc(NC(=O)c4ccc(C5CCN(CCO)CC5)cc4)c3)c(OCCOC)cc21 |
| InChI | InChI=1S/C33H38N4O6/c1-3-32(39)37-15-11-26-20-30(29(22-28(26)37)42-19-18-41-2)43-27-8-12-34-31(21-27)35-33(40)25-6-4-23(5-7-25)24-9-13-36(14-10-24)16-17-38/h4-8,11-12,15,20-22,24,38H,3,9-10,13-14,16-19H2,1-2H3,(H,34,35,40) |
| InChIKey | FTPNAJWBMUFCSG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|