C29H32N4O3 — CID 141411892
4-(1-ethylpiperidin-4-yl)-N-[4-(6-methoxy-1-methylindol-5-yl)oxy-2-pyridinyl]benzamide (PubChem CID 141411892) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 4-(1-ethylpiperidin-4-yl)-N-[4-(6-methoxy-1-methylindol-5-yl)oxy-2-pyridinyl]benzamide.
| Compound Name | 4-(1-ethylpiperidin-4-yl)-N-[4-(6-methoxy-1-methylindol-5-yl)oxy-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 141411892 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 4-(1-ethylpiperidin-4-yl)-N-[4-(6-methoxy-1-methylindol-5-yl)oxy-2-pyridinyl]benzamide |
| SMILES | CCN1CCC(c2ccc(C(=O)Nc3cc(Oc4cc5ccn(C)c5cc4OC)ccn3)cc2)CC1 |
| InChI | InChI=1S/C29H32N4O3/c1-4-33-15-11-21(12-16-33)20-5-7-22(8-6-20)29(34)31-28-18-24(9-13-30-28)36-27-17-23-10-14-32(2)25(23)19-26(27)35-3/h5-10,13-14,17-19,21H,4,11-12,15-16H2,1-3H3,(H,30,31,34) |
| InChIKey | MULJUVRTDHTQHM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |