C29H33N5O4 — CID 126762310
N-[4-[6-(3-methoxypropoxy)-1-(methylamino)indol-5-yl]oxy-2-pyridinyl]-4-(1-methylazetidin-3-yl)benzamide (PubChem CID 126762310) has the molecular formula C29H33N5O4 and a molecular weight of 515.61 g/mol. Its IUPAC name is N-[4-[6-(3-methoxypropoxy)-1-(methylamino)indol-5-yl]oxy-2-pyridinyl]-4-(1-methylazetidin-3-yl)benzamide.
| Compound Name | N-[4-[6-(3-methoxypropoxy)-1-(methylamino)indol-5-yl]oxy-2-pyridinyl]-4-(1-methylazetidin-3-yl)benzamide |
|---|---|
| PubChem CID | 126762310 |
| Molecular Formula | C29H33N5O4 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | N-[4-[6-(3-methoxypropoxy)-1-(methylamino)indol-5-yl]oxy-2-pyridinyl]-4-(1-methylazetidin-3-yl)benzamide |
| SMILES | CNn1ccc2cc(Oc3ccnc(NC(=O)c4ccc(C5CN(C)C5)cc4)c3)c(OCCCOC)cc21 |
| InChI | InChI=1S/C29H33N5O4/c1-30-34-12-10-22-15-27(26(17-25(22)34)37-14-4-13-36-3)38-24-9-11-31-28(16-24)32-29(35)21-7-5-20(6-8-21)23-18-33(2)19-23/h5-12,15-17,23,30H,4,13-14,18-19H2,1-3H3,(H,31,32,35) |
| InChIKey | MSGGBWYPQHXHLE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|