C32H39N5O2 — CID 145020757
4-(1-ethylpiperidin-4-yl)-N-[4-[3-methoxypropyl-(1-methylindol-5-yl)amino]-2-pyridinyl]benzamide (PubChem CID 145020757) has the molecular formula C32H39N5O2 and a molecular weight of 525.70 g/mol. Its IUPAC name is 4-(1-ethylpiperidin-4-yl)-N-[4-[3-methoxypropyl-(1-methylindol-5-yl)amino]-2-pyridinyl]benzamide.
| Compound Name | 4-(1-ethylpiperidin-4-yl)-N-[4-[3-methoxypropyl-(1-methylindol-5-yl)amino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 145020757 |
| Molecular Formula | C32H39N5O2 |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | 4-(1-ethylpiperidin-4-yl)-N-[4-[3-methoxypropyl-(1-methylindol-5-yl)amino]-2-pyridinyl]benzamide |
| SMILES | CCN1CCC(c2ccc(C(=O)Nc3cc(N(CCCOC)c4ccc5c(ccn5C)c4)ccn3)cc2)CC1 |
| InChI | InChI=1S/C32H39N5O2/c1-4-36-19-14-25(15-20-36)24-6-8-26(9-7-24)32(38)34-31-23-29(12-16-33-31)37(17-5-21-39-3)28-10-11-30-27(22-28)13-18-35(30)2/h6-13,16,18,22-23,25H,4-5,14-15,17,19-21H2,1-3H3,(H,33,34,38) |
| InChIKey | UIOGASBHOFPEBC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|