C33H42N6O3 — CID 145020851
ethane;5-[3-methoxypropyl-[2-[(4-piperidin-4-ylbenzoyl)amino]-4-pyridinyl]amino]-N-methylindole-1-carboxamide (PubChem CID 145020851) has the molecular formula C33H42N6O3 and a molecular weight of 570.74 g/mol. Its IUPAC name is ethane;5-[3-methoxypropyl-[2-[(4-piperidin-4-ylbenzoyl)amino]-4-pyridinyl]amino]-N-methylindole-1-carboxamide.
| Compound Name | ethane;5-[3-methoxypropyl-[2-[(4-piperidin-4-ylbenzoyl)amino]-4-pyridinyl]amino]-N-methylindole-1-carboxamide |
|---|---|
| PubChem CID | 145020851 |
| Molecular Formula | C33H42N6O3 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | ethane;5-[3-methoxypropyl-[2-[(4-piperidin-4-ylbenzoyl)amino]-4-pyridinyl]amino]-N-methylindole-1-carboxamide |
| SMILES | CC.CNC(=O)n1ccc2cc(N(CCCOC)c3ccnc(NC(=O)c4ccc(C5CCNCC5)cc4)c3)ccc21 |
| InChI | InChI=1S/C31H36N6O3.C2H6/c1-32-31(39)37-18-13-25-20-26(8-9-28(25)37)36(17-3-19-40-2)27-12-16-34-29(21-27)35-30(38)24-6-4-22(5-7-24)23-10-14-33-15-11-23;1-2/h4-9,12-13,16,18,20-21,23,33H,3,10-11,14-15,17,19H2,1-2H3,(H,32,39)(H,34,35,38);1-2H3 |
| InChIKey | MJHNFQNHYPKVOO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|