C33H42N6O3 — CID 145020833
N-[4-[(2-methoxy-2-methylpropyl)-(1-methylindol-5-yl)amino]-2-pyridinyl]-4-piperidin-4-ylbenzamide;N-methylformamide (PubChem CID 145020833) has the molecular formula C33H42N6O3 and a molecular weight of 570.74 g/mol. Its IUPAC name is N-[4-[(2-methoxy-2-methylpropyl)-(1-methylindol-5-yl)amino]-2-pyridinyl]-4-piperidin-4-ylbenzamide;N-methylformamide.
| Compound Name | N-[4-[(2-methoxy-2-methylpropyl)-(1-methylindol-5-yl)amino]-2-pyridinyl]-4-piperidin-4-ylbenzamide;N-methylformamide |
|---|---|
| PubChem CID | 145020833 |
| Molecular Formula | C33H42N6O3 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | N-[4-[(2-methoxy-2-methylpropyl)-(1-methylindol-5-yl)amino]-2-pyridinyl]-4-piperidin-4-ylbenzamide;N-methylformamide |
| SMILES | CNC=O.COC(C)(C)CN(c1ccnc(NC(=O)c2ccc(C3CCNCC3)cc2)c1)c1ccc2c(ccn2C)c1 |
| InChI | InChI=1S/C31H37N5O2.C2H5NO/c1-31(2,38-4)21-36(26-9-10-28-25(19-26)14-18-35(28)3)27-13-17-33-29(20-27)34-30(37)24-7-5-22(6-8-24)23-11-15-32-16-12-23;1-3-2-4/h5-10,13-14,17-20,23,32H,11-12,15-16,21H2,1-4H3,(H,33,34,37);2H,1H3,(H,3,4) |
| InChIKey | BJTWNFPJYUXCDH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|