C32H37N5O6 — CID 129275005
5-[[2-[[4-[1-(2-hydroxyethyl)piperidin-4-yl]benzoyl]amino]-3-pyridinyl]oxy]-6-(2-methoxyethoxy)-N-methylindole-1-carboxamide (PubChem CID 129275005) has the molecular formula C32H37N5O6 and a molecular weight of 587.68 g/mol. Its IUPAC name is 5-[[2-[[4-[1-(2-hydroxyethyl)piperidin-4-yl]benzoyl]amino]-3-pyridinyl]oxy]-6-(2-methoxyethoxy)-N-methylindole-1-carboxamide.
| Compound Name | 5-[[2-[[4-[1-(2-hydroxyethyl)piperidin-4-yl]benzoyl]amino]-3-pyridinyl]oxy]-6-(2-methoxyethoxy)-N-methylindole-1-carboxamide |
|---|---|
| PubChem CID | 129275005 |
| Molecular Formula | C32H37N5O6 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | 5-[[2-[[4-[1-(2-hydroxyethyl)piperidin-4-yl]benzoyl]amino]-3-pyridinyl]oxy]-6-(2-methoxyethoxy)-N-methylindole-1-carboxamide |
| SMILES | CNC(=O)n1ccc2cc(Oc3cccnc3NC(=O)c3ccc(C4CCN(CCO)CC4)cc3)c(OCCOC)cc21 |
| InChI | InChI=1S/C32H37N5O6/c1-33-32(40)37-15-11-25-20-29(28(21-26(25)37)42-19-18-41-2)43-27-4-3-12-34-30(27)35-31(39)24-7-5-22(6-8-24)23-9-13-36(14-10-23)16-17-38/h3-8,11-12,15,20-21,23,38H,9-10,13-14,16-19H2,1-2H3,(H,33,40)(H,34,35,39) |
| InChIKey | YIDIGTPKARDGIH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|