C33H42N6O5 — CID 126762316
6-(2-methoxyethoxy)-N-methyl-5-[[2-[[(2E)-2-[(1-propan-2-ylpiperidin-4-yl)methyliminomethyl]penta-2,4-dienoyl]amino]-4-pyridinyl]oxy]indole-1-carboxamide (PubChem CID 126762316) has the molecular formula C33H42N6O5 and a molecular weight of 602.74 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-N-methyl-5-[[2-[[(2E)-2-[(1-propan-2-ylpiperidin-4-yl)methyliminomethyl]penta-2,4-dienoyl]amino]-4-pyridinyl]oxy]indole-1-carboxamide.
| Compound Name | 6-(2-methoxyethoxy)-N-methyl-5-[[2-[[(2E)-2-[(1-propan-2-ylpiperidin-4-yl)methyliminomethyl]penta-2,4-dienoyl]amino]-4-pyridinyl]oxy]indole-1-carboxamide |
|---|---|
| PubChem CID | 126762316 |
| Molecular Formula | C33H42N6O5 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | 6-(2-methoxyethoxy)-N-methyl-5-[[2-[[(2E)-2-[(1-propan-2-ylpiperidin-4-yl)methyliminomethyl]penta-2,4-dienoyl]amino]-4-pyridinyl]oxy]indole-1-carboxamide |
| SMILES | C=C/C=C(\C=N\CC1CCN(C(C)C)CC1)C(=O)Nc1cc(Oc2cc3ccn(C(=O)NC)c3cc2OCCOC)ccn1 |
| InChI | InChI=1S/C33H42N6O5/c1-6-7-26(22-35-21-24-9-13-38(14-10-24)23(2)3)32(40)37-31-19-27(8-12-36-31)44-30-18-25-11-15-39(33(41)34-4)28(25)20-29(30)43-17-16-42-5/h6-8,11-12,15,18-20,22-24H,1,9-10,13-14,16-17,21H2,2-5H3,(H,34,41)(H,36,37,40)/b26-7+,35-22+ |
| InChIKey | LPKXQQXMHUNWDO-PFKSWHCGSA-N |
| XLogP | 5.28 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|