C22H22F2N4O5 — CID 58930854
4-[3-fluoro-4-(2-fluoroethylcarbamoylamino)phenoxy]-7-(2-methoxyethoxy)quinoline-6-carboxamide (PubChem CID 58930854) has the molecular formula C22H22F2N4O5 and a molecular weight of 460.44 g/mol. Its IUPAC name is 4-[3-fluoro-4-(2-fluoroethylcarbamoylamino)phenoxy]-7-(2-methoxyethoxy)quinoline-6-carboxamide.
| Compound Name | 4-[3-fluoro-4-(2-fluoroethylcarbamoylamino)phenoxy]-7-(2-methoxyethoxy)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 58930854 |
| Molecular Formula | C22H22F2N4O5 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 4-[3-fluoro-4-(2-fluoroethylcarbamoylamino)phenoxy]-7-(2-methoxyethoxy)quinoline-6-carboxamide |
| SMILES | COCCOc1cc2nccc(Oc3ccc(NC(=O)NCCF)c(F)c3)c2cc1C(N)=O |
| InChI | InChI=1S/C22H22F2N4O5/c1-31-8-9-32-20-12-18-14(11-15(20)21(25)29)19(4-6-26-18)33-13-2-3-17(16(24)10-13)28-22(30)27-7-5-23/h2-4,6,10-12H,5,7-9H2,1H3,(H2,25,29)(H2,27,28,30) |
| InChIKey | LBXBIAKHCWUUHZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|