C21H21ClFN3O4 — CID 89363640
4-(4-amino-3-chlorophenoxy)-N-(2-fluoroethyl)-7-(2-methoxyethoxy)quinoline-6-carboxamide (PubChem CID 89363640) has the molecular formula C21H21ClFN3O4 and a molecular weight of 433.87 g/mol. Its IUPAC name is 4-(4-amino-3-chlorophenoxy)-N-(2-fluoroethyl)-7-(2-methoxyethoxy)quinoline-6-carboxamide.
| Compound Name | 4-(4-amino-3-chlorophenoxy)-N-(2-fluoroethyl)-7-(2-methoxyethoxy)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 89363640 |
| Molecular Formula | C21H21ClFN3O4 |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 4-(4-amino-3-chlorophenoxy)-N-(2-fluoroethyl)-7-(2-methoxyethoxy)quinoline-6-carboxamide |
| SMILES | COCCOc1cc2nccc(Oc3ccc(N)c(Cl)c3)c2cc1C(=O)NCCF |
| InChI | InChI=1S/C21H21ClFN3O4/c1-28-8-9-29-20-12-18-14(11-15(20)21(27)26-7-5-23)19(4-6-25-18)30-13-2-3-17(24)16(22)10-13/h2-4,6,10-12H,5,7-9,24H2,1H3,(H,26,27) |
| InChIKey | RPTBRIRJXYGTKP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|