C19H19ClN2O4 — CID 145166636
4-(4-amino-3-chlorophenoxy)-7-methoxyquinoline-6-carbaldehyde;methoxymethane (PubChem CID 145166636) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is 4-(4-amino-3-chlorophenoxy)-7-methoxyquinoline-6-carbaldehyde;methoxymethane.
| Compound Name | 4-(4-amino-3-chlorophenoxy)-7-methoxyquinoline-6-carbaldehyde;methoxymethane |
|---|---|
| PubChem CID | 145166636 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-(4-amino-3-chlorophenoxy)-7-methoxyquinoline-6-carbaldehyde;methoxymethane |
| SMILES | COC.COc1cc2nccc(Oc3ccc(N)c(Cl)c3)c2cc1C=O |
| InChI | InChI=1S/C17H13ClN2O3.C2H6O/c1-22-17-8-15-12(6-10(17)9-21)16(4-5-20-15)23-11-2-3-14(19)13(18)7-11;1-3-2/h2-9H,19H2,1H3;1-2H3 |
| InChIKey | RBPNAUFGSMHLHH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|