C27H19ClN4O5 — CID 134334024
4-[3-chloro-4-[[3,4-dioxo-2-(pyridin-3-ylmethylamino)cyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carbaldehyde (PubChem CID 134334024) has the molecular formula C27H19ClN4O5 and a molecular weight of 514.93 g/mol. Its IUPAC name is 4-[3-chloro-4-[[3,4-dioxo-2-(pyridin-3-ylmethylamino)cyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carbaldehyde.
| Compound Name | 4-[3-chloro-4-[[3,4-dioxo-2-(pyridin-3-ylmethylamino)cyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carbaldehyde |
|---|---|
| PubChem CID | 134334024 |
| Molecular Formula | C27H19ClN4O5 |
| Molecular Weight | 514.93 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 4-[3-chloro-4-[[3,4-dioxo-2-(pyridin-3-ylmethylamino)cyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carbaldehyde |
| SMILES | COc1cc2nccc(Oc3ccc(Nc4c(NCc5cccnc5)c(=O)c4=O)c(Cl)c3)c2cc1C=O |
| InChI | InChI=1S/C27H19ClN4O5/c1-36-23-11-21-18(9-16(23)14-33)22(6-8-30-21)37-17-4-5-20(19(28)10-17)32-25-24(26(34)27(25)35)31-13-15-3-2-7-29-12-15/h2-12,14,31-32H,13H2,1H3 |
| InChIKey | PRJBHJAKDIEEOH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.93 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|