C29H38ClN5O3S — CID 145166584
1-[2-chloro-4-(6-formyl-7-methoxyquinolin-4-yl)oxyphenyl]-3-cyclopropylthiourea;N',N'-diethyl-N-methylpropane-1,3-diamine (PubChem CID 145166584) has the molecular formula C29H38ClN5O3S and a molecular weight of 572.18 g/mol. Its IUPAC name is 1-[2-chloro-4-(6-formyl-7-methoxyquinolin-4-yl)oxyphenyl]-3-cyclopropylthiourea;N',N'-diethyl-N-methylpropane-1,3-diamine.
| Compound Name | 1-[2-chloro-4-(6-formyl-7-methoxyquinolin-4-yl)oxyphenyl]-3-cyclopropylthiourea;N',N'-diethyl-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 145166584 |
| Molecular Formula | C29H38ClN5O3S |
| Molecular Weight | 572.18 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 1-[2-chloro-4-(6-formyl-7-methoxyquinolin-4-yl)oxyphenyl]-3-cyclopropylthiourea;N',N'-diethyl-N-methylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNC.COc1cc2nccc(Oc3ccc(NC(=S)NC4CC4)c(Cl)c3)c2cc1C=O |
| InChI | InChI=1S/C21H18ClN3O3S.C8H20N2/c1-27-20-10-18-15(8-12(20)11-26)19(6-7-23-18)28-14-4-5-17(16(22)9-14)25-21(29)24-13-2-3-13;1-4-10(5-2)8-6-7-9-3/h4-11,13H,2-3H2,1H3,(H2,24,25,29);9H,4-8H2,1-3H3 |
| InChIKey | DVFVOZSRHMGYDY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.18 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|