C26H28ClN5O4 — CID 67305858
4-[2-amino-3-chloro-4-(cyclopropylcarbamoyl)phenoxy]-7-(piperidin-4-ylmethoxy)quinoline-6-carboxamide (PubChem CID 67305858) has the molecular formula C26H28ClN5O4 and a molecular weight of 509.99 g/mol. Its IUPAC name is 4-[2-amino-3-chloro-4-(cyclopropylcarbamoyl)phenoxy]-7-(piperidin-4-ylmethoxy)quinoline-6-carboxamide.
| Compound Name | 4-[2-amino-3-chloro-4-(cyclopropylcarbamoyl)phenoxy]-7-(piperidin-4-ylmethoxy)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 67305858 |
| Molecular Formula | C26H28ClN5O4 |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 4-[2-amino-3-chloro-4-(cyclopropylcarbamoyl)phenoxy]-7-(piperidin-4-ylmethoxy)quinoline-6-carboxamide |
| SMILES | NC(=O)c1cc2c(Oc3ccc(C(=O)NC4CC4)c(Cl)c3N)ccnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C26H28ClN5O4/c27-23-16(26(34)32-15-1-2-15)3-4-21(24(23)28)36-20-7-10-31-19-12-22(18(25(29)33)11-17(19)20)35-13-14-5-8-30-9-6-14/h3-4,7,10-12,14-15,30H,1-2,5-6,8-9,13,28H2,(H2,29,33)(H,32,34) |
| InChIKey | KYSUGHHSTIXJBV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|